C29H33F2N3O6S4 — CID 59883255
4-[(2Z)-2-[(2Z)-2-[[3-[4-(ethylsulfonylamino)-4-oxobutyl]-5-fluoro-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-fluoro-1,3-benzothiazol-3-yl]butane-1-sulfonate (PubChem CID 59883255) has the molecular formula C29H33F2N3O6S4 and a molecular weight of 685.86 g/mol. Its IUPAC name is 4-[(2Z)-2-[(2Z)-2-[[3-[4-(ethylsulfonylamino)-4-oxobutyl]-5-fluoro-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-fluoro-1,3-benzothiazol-3-yl]butane-1-sulfonate.
| Compound Name | 4-[(2Z)-2-[(2Z)-2-[[3-[4-(ethylsulfonylamino)-4-oxobutyl]-5-fluoro-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-fluoro-1,3-benzothiazol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59883255 |
| Molecular Formula | C29H33F2N3O6S4 |
| Molecular Weight | 685.86 g/mol |
| Exact Mass | 685.12 |
| IUPAC Name | 4-[(2Z)-2-[(2Z)-2-[[3-[4-(ethylsulfonylamino)-4-oxobutyl]-5-fluoro-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-fluoro-1,3-benzothiazol-3-yl]butane-1-sulfonate |
| SMILES | CCC(=C/c1sc2ccc(F)cc2[n+]1CCCC(=O)NS(=O)(=O)CC)/C=C1\Sc2ccc(F)cc2N1CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C29H33F2N3O6S4/c1-3-20(16-28-33(13-5-6-15-44(38,39)40)23-18-21(30)9-11-25(23)41-28)17-29-34(24-19-22(31)10-12-26(24)42-29)14-7-8-27(35)32-43(36,37)4-2/h9-12,16-19H,3-8,13-15H2,1-2H3,(H-,32,35,38,39,40) |
| InChIKey | MZWDXSNRMCRQKT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|