C33H36KN2O6S4+ — CID 59894715
potassium 4-[5,6-dimethyl-2-[(E)-2-[(Z)-[5-phenyl-3-(2-sulfoethyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate (PubChem CID 59894715) has the molecular formula C33H36KN2O6S4+ and a molecular weight of 724.03 g/mol. Its IUPAC name is potassium 4-[5,6-dimethyl-2-[(E)-2-[(Z)-[5-phenyl-3-(2-sulfoethyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate.
| Compound Name | potassium 4-[5,6-dimethyl-2-[(E)-2-[(Z)-[5-phenyl-3-(2-sulfoethyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59894715 |
| Molecular Formula | C33H36KN2O6S4+ |
| Molecular Weight | 724.03 g/mol |
| Exact Mass | 723.11 |
| IUPAC Name | potassium 4-[5,6-dimethyl-2-[(E)-2-[(Z)-[5-phenyl-3-(2-sulfoethyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate |
| SMILES | CCC(/C=C1\Sc2ccc(-c3ccccc3)cc2N1CCS(=O)(=O)O)=C\c1sc2cc(C)c(C)cc2[n+]1CCCCS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C33H36N2O6S4.K/c1-4-25(20-32-34(14-8-9-16-44(36,37)38)28-18-23(2)24(3)19-31(28)43-32)21-33-35(15-17-45(39,40)41)29-22-27(12-13-30(29)42-33)26-10-6-5-7-11-26;/h5-7,10-13,18-22H,4,8-9,14-17H2,1-3H3,(H-,36,37,38,39,40,41);/q;+1 |
| InChIKey | VOMQIWLPMCRHSN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.03 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|