C47H40N2O5S3 — CID 59040045
4-[2-[2-[2-[[3-(2-phenoxyethyl)-5-phenyl-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzothiazol-3-yl]ethoxy]benzenesulfonate (PubChem CID 59040045) has the molecular formula C47H40N2O5S3 and a molecular weight of 809.05 g/mol. Its IUPAC name is 4-[2-[2-[2-[[3-(2-phenoxyethyl)-5-phenyl-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzothiazol-3-yl]ethoxy]benzenesulfonate.
| Compound Name | 4-[2-[2-[2-[[3-(2-phenoxyethyl)-5-phenyl-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzothiazol-3-yl]ethoxy]benzenesulfonate |
|---|---|
| PubChem CID | 59040045 |
| Molecular Formula | C47H40N2O5S3 |
| Molecular Weight | 809.05 g/mol |
| Exact Mass | 808.21 |
| IUPAC Name | 4-[2-[2-[2-[[3-(2-phenoxyethyl)-5-phenyl-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzothiazol-3-yl]ethoxy]benzenesulfonate |
| SMILES | CCC(=Cc1sc2ccc(-c3ccccc3)cc2[n+]1CCOc1ccccc1)C=C1Sc2ccc(-c3ccccc3)cc2N1CCOc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C47H40N2O5S3/c1-2-34(30-46-48(26-28-53-39-16-10-5-11-17-39)42-32-37(18-24-44(42)55-46)35-12-6-3-7-13-35)31-47-49(27-29-54-40-20-22-41(23-21-40)57(50,51)52)43-33-38(19-25-45(43)56-47)36-14-8-4-9-15-36/h3-25,30-33H,2,26-29H2,1H3 |
| InChIKey | HGSUZRHHBAQWIR-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.05 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|