C51H49N2O6S2+ — CID 59040048
4-[2-[2-[5-phenyl-2-[2-[[5-phenyl-3-(4-phenylbutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]ethoxy]ethoxy]benzenesulfonic acid (PubChem CID 59040048) has the molecular formula C51H49N2O6S2+ and a molecular weight of 850.10 g/mol. Its IUPAC name is 4-[2-[2-[5-phenyl-2-[2-[[5-phenyl-3-(4-phenylbutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]ethoxy]ethoxy]benzenesulfonic acid.
| Compound Name | 4-[2-[2-[5-phenyl-2-[2-[[5-phenyl-3-(4-phenylbutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]ethoxy]ethoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 59040048 |
| Molecular Formula | C51H49N2O6S2+ |
| Molecular Weight | 850.10 g/mol |
| Exact Mass | 849.30 |
| IUPAC Name | 4-[2-[2-[5-phenyl-2-[2-[[5-phenyl-3-(4-phenylbutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]ethoxy]ethoxy]benzenesulfonic acid |
| SMILES | CCC(=Cc1sc2ccc(-c3ccccc3)cc2[n+]1CCCCc1ccccc1)C=C1Oc2ccc(-c3ccccc3)cc2N1CCOCCOc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C51H48N2O6S2/c1-2-38(35-51-53(29-13-12-16-39-14-6-3-7-15-39)47-37-43(22-28-49(47)60-51)41-19-10-5-11-20-41)34-50-52(46-36-42(21-27-48(46)59-50)40-17-8-4-9-18-40)30-31-57-32-33-58-44-23-25-45(26-24-44)61(54,55)56/h3-11,14-15,17-28,34-37H,2,12-13,16,29-33H2,1H3/p+1 |
| InChIKey | YNCKMVRDPOMRKM-UHFFFAOYSA-O |
| XLogP | 11.42 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.10 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|