C31H29N2O9S3- — CID 59104886
3-[7-[2-[[5-phenyl-3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-[1,3]dioxolo[4,5-g][1,3]benzothiazol-6-ium-6-yl]propane-1-sulfonate (PubChem CID 59104886) has the molecular formula C31H29N2O9S3- and a molecular weight of 669.78 g/mol. Its IUPAC name is 3-[7-[2-[[5-phenyl-3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-[1,3]dioxolo[4,5-g][1,3]benzothiazol-6-ium-6-yl]propane-1-sulfonate.
| Compound Name | 3-[7-[2-[[5-phenyl-3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-[1,3]dioxolo[4,5-g][1,3]benzothiazol-6-ium-6-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59104886 |
| Molecular Formula | C31H29N2O9S3- |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.10 |
| IUPAC Name | 3-[7-[2-[[5-phenyl-3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-[1,3]dioxolo[4,5-g][1,3]benzothiazol-6-ium-6-yl]propane-1-sulfonate |
| SMILES | CCC(=Cc1sc2c3c(ccc2[n+]1CCCS(=O)(=O)[O-])OCO3)C=C1Oc2ccc(-c3ccccc3)cc2N1CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C31H30N2O9S3/c1-2-21(18-29-33(13-6-15-44(34,35)36)24-10-12-27-30(31(24)43-29)41-20-40-27)17-28-32(14-16-45(37,38)39)25-19-23(9-11-26(25)42-28)22-7-4-3-5-8-22/h3-5,7-12,17-19H,2,6,13-16,20H2,1H3,(H-,34,35,36,37,38,39)/p-1 |
| InChIKey | OGMWFYMFMNISDH-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 149.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|