C34H38N2NaO9S3 — CID 170839938
CID 170839938 (PubChem CID 170839938) has the molecular formula C34H38N2NaO9S3 and a molecular weight of 737.87 g/mol.
| Compound Name | CID 170839938 |
|---|---|
| PubChem CID | 170839938 |
| Molecular Formula | C34H38N2NaO9S3 |
| Molecular Weight | 737.87 g/mol |
| Exact Mass | 737.16 |
| IUPAC Name | — |
| SMILES | CCC(=Cc1sc2cc(OC)c(OC)cc2[n+]1CCCS(=O)(=O)O)C=C1Oc2ccc(-c3ccccc3)cc2N1CCC(C)S(=O)(=O)[O-].[Na] |
| InChI | InChI=1S/C34H38N2O9S3.Na/c1-5-24(19-34-36(15-9-17-47(37,38)39)28-21-30(43-3)31(44-4)22-32(28)46-34)18-33-35(16-14-23(2)48(40,41)42)27-20-26(12-13-29(27)45-33)25-10-7-6-8-11-25;/h6-8,10-13,18-23H,5,9,14-17H2,1-4H3,(H-,37,38,39,40,41,42); |
| InChIKey | ZAWGSFJCCPCCEM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.87 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|