C43H48N3O5S2+ — CID 91487251
3-[2-[2-[[3-[1-oxo-1-(propylamino)hexan-2-yl]-5-phenyl-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid (PubChem CID 91487251) has the molecular formula C43H48N3O5S2+ and a molecular weight of 751.01 g/mol. Its IUPAC name is 3-[2-[2-[[3-[1-oxo-1-(propylamino)hexan-2-yl]-5-phenyl-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-[[3-[1-oxo-1-(propylamino)hexan-2-yl]-5-phenyl-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91487251 |
| Molecular Formula | C43H48N3O5S2+ |
| Molecular Weight | 751.01 g/mol |
| Exact Mass | 750.30 |
| IUPAC Name | 3-[2-[2-[[3-[1-oxo-1-(propylamino)hexan-2-yl]-5-phenyl-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCCCC(C(=O)NCCC)[n+]1c(C=C(C=C2Oc3ccc(-c4ccccc4)cc3N2CCCS(=O)(=O)O)CC)sc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C43H47N3O5S2/c1-4-7-19-36(43(47)44-24-5-2)46-38-30-35(33-17-12-9-13-18-33)21-23-40(38)52-42(46)28-31(6-3)27-41-45(25-14-26-53(48,49)50)37-29-34(20-22-39(37)51-41)32-15-10-8-11-16-32/h8-13,15-18,20-23,27-30,36H,4-7,14,19,24-26H2,1-3H3,(H-,44,47,48,49,50)/p+1 |
| InChIKey | KMXKZPFOFDGHDR-UHFFFAOYSA-O |
| XLogP | 9.59 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.01 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|