C30H26N2O3S3 — CID 59961149
4-[2-[(1-methylbenzo[e][1,3]benzothiazol-1-ium-2-yl)methylidene]-5-phenyl-1,3-benzothiazol-3-yl]butane-1-sulfonate (PubChem CID 59961149) has the molecular formula C30H26N2O3S3 and a molecular weight of 558.75 g/mol. Its IUPAC name is 4-[2-[(1-methylbenzo[e][1,3]benzothiazol-1-ium-2-yl)methylidene]-5-phenyl-1,3-benzothiazol-3-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[(1-methylbenzo[e][1,3]benzothiazol-1-ium-2-yl)methylidene]-5-phenyl-1,3-benzothiazol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59961149 |
| Molecular Formula | C30H26N2O3S3 |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 4-[2-[(1-methylbenzo[e][1,3]benzothiazol-1-ium-2-yl)methylidene]-5-phenyl-1,3-benzothiazol-3-yl]butane-1-sulfonate |
| SMILES | C[n+]1c(C=C2Sc3ccc(-c4ccccc4)cc3N2CCCCS(=O)(=O)[O-])sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C30H26N2O3S3/c1-31-28(37-27-16-13-22-11-5-6-12-24(22)30(27)31)20-29-32(17-7-8-18-38(33,34)35)25-19-23(14-15-26(25)36-29)21-9-3-2-4-10-21/h2-6,9-16,19-20H,7-8,17-18H2,1H3 |
| InChIKey | LLAGVFZDNOCFSF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|