C23H26N3O3S2+ — CID 162051975
3-[2-[[1-(3-aminopropyl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 162051975) has the molecular formula C23H26N3O3S2+ and a molecular weight of 456.61 g/mol. Its IUPAC name is 3-[2-[[1-(3-aminopropyl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[[1-(3-aminopropyl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 162051975 |
| Molecular Formula | C23H26N3O3S2+ |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 3-[2-[[1-(3-aminopropyl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | NCCC[n+]1ccc(C=C2Sc3ccccc3N2CCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C23H25N3O3S2/c24-12-5-13-25-15-11-18(19-7-1-2-8-20(19)25)17-23-26(14-6-16-31(27,28)29)21-9-3-4-10-22(21)30-23/h1-4,7-11,15,17H,5-6,12-14,16,24H2/p+1 |
| InChIKey | YYQXWXCTMYWUAO-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|