C26H31ClN4OS — CID 155560771
N-(6-aminohexyl)-2-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]acetamide chloride (PubChem CID 155560771) has the molecular formula C26H31ClN4OS and a molecular weight of 483.08 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]acetamide chloride.
| Compound Name | N-(6-aminohexyl)-2-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]acetamide chloride |
|---|---|
| PubChem CID | 155560771 |
| Molecular Formula | C26H31ClN4OS |
| Molecular Weight | 483.08 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-(6-aminohexyl)-2-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]acetamide chloride |
| SMILES | CN1/C(=C/c2cc[n+](CC(=O)NCCCCCCN)c3ccccc23)Sc2ccccc21.[Cl-] |
| InChI | InChI=1S/C26H30N4OS.ClH/c1-29-23-12-6-7-13-24(23)32-26(29)18-20-14-17-30(22-11-5-4-10-21(20)22)19-25(31)28-16-9-3-2-8-15-27;/h4-7,10-14,17-18H,2-3,8-9,15-16,19,27H2,1H3;1H |
| InChIKey | PDYAFNFSKHWAJB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.08 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|