C26H33N6OS+ — CID 155536755
N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-2-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]acetamide (PubChem CID 155536755) has the molecular formula C26H33N6OS+ and a molecular weight of 477.66 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-2-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]acetamide.
| Compound Name | N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-2-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 155536755 |
| Molecular Formula | C26H33N6OS+ |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]-2-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]acetamide |
| SMILES | CN1/C(=C/c2cc[n+](CC(=O)NCCNCCNCCN)c3ccccc23)Sc2ccccc21 |
| InChI | InChI=1S/C26H32N6OS/c1-31-23-8-4-5-9-24(23)34-26(31)18-20-10-17-32(22-7-3-2-6-21(20)22)19-25(33)30-16-15-29-14-13-28-12-11-27/h2-10,17-18,28-29H,11-16,19,27H2,1H3/p+1 |
| InChIKey | SURPCCSZHKKEQS-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|