C39H53IN6O5S — CID 158324669
tert-butyl N-[6-acetamido-1-[2-[6-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]hexanoylamino]ethylamino]-1-oxohexan-2-yl]carbamate iodide (PubChem CID 158324669) has the molecular formula C39H53IN6O5S and a molecular weight of 844.86 g/mol. Its IUPAC name is tert-butyl N-[6-acetamido-1-[2-[6-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]hexanoylamino]ethylamino]-1-oxohexan-2-yl]carbamate iodide.
| Compound Name | tert-butyl N-[6-acetamido-1-[2-[6-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]hexanoylamino]ethylamino]-1-oxohexan-2-yl]carbamate iodide |
|---|---|
| PubChem CID | 158324669 |
| Molecular Formula | C39H53IN6O5S |
| Molecular Weight | 844.86 g/mol |
| Exact Mass | 844.28 |
| IUPAC Name | tert-butyl N-[6-acetamido-1-[2-[6-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]hexanoylamino]ethylamino]-1-oxohexan-2-yl]carbamate iodide |
| SMILES | CC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)NCCNC(=O)CCCCC[n+]1ccc(C=C2Sc3ccccc3N2C)c2ccccc21.[I-] |
| InChI | InChI=1S/C39H52N6O5S.HI/c1-28(46)40-22-13-12-16-31(43-38(49)50-39(2,3)4)37(48)42-24-23-41-35(47)20-7-6-14-25-45-26-21-29(30-15-8-9-17-32(30)45)27-36-44(5)33-18-10-11-19-34(33)51-36;/h8-11,15,17-19,21,26-27,31H,6-7,12-14,16,20,22-25H2,1-5H3,(H3-,40,41,42,43,46,47,48,49);1H |
| InChIKey | UKYKXIZJDSCVJF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|