C33H35N2O2S+ — CID 167604342
4-[2-[5-[1-(4-hydroxybutyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]benzo[g][1,3]benzothiazol-3-yl]butan-1-ol (PubChem CID 167604342) has the molecular formula C33H35N2O2S+ and a molecular weight of 523.72 g/mol. Its IUPAC name is 4-[2-[5-[1-(4-hydroxybutyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]benzo[g][1,3]benzothiazol-3-yl]butan-1-ol.
| Compound Name | 4-[2-[5-[1-(4-hydroxybutyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]benzo[g][1,3]benzothiazol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 167604342 |
| Molecular Formula | C33H35N2O2S+ |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 4-[2-[5-[1-(4-hydroxybutyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]benzo[g][1,3]benzothiazol-3-yl]butan-1-ol |
| SMILES | OCCCCN1C(=CC=CC=Cc2cc[n+](CCCCO)c3ccccc23)Sc2c1ccc1ccccc21 |
| InChI | InChI=1S/C33H35N2O2S/c36-24-10-8-21-34-23-20-27(28-14-6-7-16-30(28)34)12-2-1-3-17-32-35(22-9-11-25-37)31-19-18-26-13-4-5-15-29(26)33(31)38-32/h1-7,12-20,23,36-37H,8-11,21-22,24-25H2/q+1 |
| InChIKey | KEGHUMBKUNRVEA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|