C27H24N3OS+ — CID 170839910
2-[4-[3-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]acetamide (PubChem CID 170839910) has the molecular formula C27H24N3OS+ and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-[4-[3-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]acetamide.
| Compound Name | 2-[4-[3-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 170839910 |
| Molecular Formula | C27H24N3OS+ |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[4-[3-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]acetamide |
| SMILES | CCN1C(=CC=Cc2cc[n+](CC(N)=O)c3ccccc23)Sc2c1ccc1ccccc21 |
| InChI | InChI=1S/C27H23N3OS/c1-2-30-24-15-14-19-8-3-4-11-22(19)27(24)32-26(30)13-7-9-20-16-17-29(18-25(28)31)23-12-6-5-10-21(20)23/h3-17H,2,18H2,1H3,(H-,28,31)/p+1 |
| InChIKey | FBVXKVPVWBUTSR-UHFFFAOYSA-O |
| XLogP | 5.25 |
| TPSA | 50.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|