C25H24ClN2O2S+ — CID 164820531
2-[4-[(E,3Z)-3-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethyl acetate (PubChem CID 164820531) has the molecular formula C25H24ClN2O2S+ and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-[4-[(E,3Z)-3-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethyl acetate.
| Compound Name | 2-[4-[(E,3Z)-3-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 164820531 |
| Molecular Formula | C25H24ClN2O2S+ |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 2-[4-[(E,3Z)-3-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethyl acetate |
| SMILES | CCN1/C(=C/C=C/c2cc[n+](CCOC(C)=O)c3ccccc23)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H24ClN2O2S/c1-3-28-23-17-20(26)11-12-24(23)31-25(28)10-6-7-19-13-14-27(15-16-30-18(2)29)22-9-5-4-8-21(19)22/h4-14,17H,3,15-16H2,1-2H3/q+1 |
| InChIKey | JTHCCRAHIBOTKM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|