C23H20BrClN2OS — CID 174152235
2-[2-[3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-5-chloro-1,3-benzothiazol-3-yl]ethanolate (PubChem CID 174152235) has the molecular formula C23H20BrClN2OS and a molecular weight of 487.85 g/mol. Its IUPAC name is 2-[2-[3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-5-chloro-1,3-benzothiazol-3-yl]ethanolate.
| Compound Name | 2-[2-[3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-5-chloro-1,3-benzothiazol-3-yl]ethanolate |
|---|---|
| PubChem CID | 174152235 |
| Molecular Formula | C23H20BrClN2OS |
| Molecular Weight | 487.85 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 2-[2-[3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-5-chloro-1,3-benzothiazol-3-yl]ethanolate |
| SMILES | CC[n+]1ccc(C=CC=C2Sc3ccc(Cl)cc3N2CC[O-])c2ccc(Br)cc21 |
| InChI | InChI=1S/C23H20BrClN2OS/c1-2-26-11-10-16(19-8-6-17(24)14-20(19)26)4-3-5-23-27(12-13-28)21-15-18(25)7-9-22(21)29-23/h3-11,14-15H,2,12-13H2,1H3 |
| InChIKey | IMMWNKADOJDVDY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.85 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|