C23H21BrKN2OS+ — CID 165095661
potassium 2-[5-bromo-2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanolate (PubChem CID 165095661) has the molecular formula C23H21BrKN2OS+ and a molecular weight of 492.50 g/mol. Its IUPAC name is potassium 2-[5-bromo-2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanolate.
| Compound Name | potassium 2-[5-bromo-2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanolate |
|---|---|
| PubChem CID | 165095661 |
| Molecular Formula | C23H21BrKN2OS+ |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | potassium 2-[5-bromo-2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanolate |
| SMILES | CC[n+]1ccc(C=CC=C2Sc3ccc(Br)cc3N2CC[O-])c2ccccc21.[K+] |
| InChI | InChI=1S/C23H21BrN2OS.K/c1-2-25-13-12-17(19-7-3-4-8-20(19)25)6-5-9-23-26(14-15-27)21-16-18(24)10-11-22(21)28-23;/h3-13,16H,2,14-15H2,1H3;/q;+1 |
| InChIKey | DAAKTLOCGMMDJL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|