C24H25N2O2S+ — CID 73176251
2-[2-[3-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]prop-2-enylidene]-6-methyl-1,3-benzothiazol-3-yl]ethanol (PubChem CID 73176251) has the molecular formula C24H25N2O2S+ and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[2-[3-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]prop-2-enylidene]-6-methyl-1,3-benzothiazol-3-yl]ethanol.
| Compound Name | 2-[2-[3-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]prop-2-enylidene]-6-methyl-1,3-benzothiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 73176251 |
| Molecular Formula | C24H25N2O2S+ |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[2-[3-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]prop-2-enylidene]-6-methyl-1,3-benzothiazol-3-yl]ethanol |
| SMILES | Cc1ccc2c(c1)SC(=CC=Cc1cc[n+](CCO)c3ccccc13)N2CCO |
| InChI | InChI=1S/C24H25N2O2S/c1-18-9-10-22-23(17-18)29-24(26(22)14-16-28)8-4-5-19-11-12-25(13-15-27)21-7-3-2-6-20(19)21/h2-12,17,27-28H,13-16H2,1H3/q+1 |
| InChIKey | TWUFEUDULVSMQU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|