C27H24ClN3OS — CID 170842414
2-[4-[3-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethanimidate;hydrochloride (PubChem CID 170842414) has the molecular formula C27H24ClN3OS and a molecular weight of 474.03 g/mol. Its IUPAC name is 2-[4-[3-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethanimidate;hydrochloride.
| Compound Name | 2-[4-[3-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethanimidate;hydrochloride |
|---|---|
| PubChem CID | 170842414 |
| Molecular Formula | C27H24ClN3OS |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[4-[3-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\[O-])C[n+]1ccc(C=CC=C2Sc3ccc4ccccc4c3N2CC)c2ccccc21 |
| InChI | InChI=1S/C27H23N3OS.ClH/c1-2-30-26(32-24-15-14-19-8-3-4-11-22(19)27(24)30)13-7-9-20-16-17-29(18-25(28)31)23-12-6-5-10-21(20)23;/h3-17H,2,18H2,1H3,(H-,28,31);1H |
| InChIKey | UOCLSBOPNXAPHY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|