C35H34N2O3S2 — CID 162340128
1-ethyl-2-[3-(1-propan-2-ylquinolin-1-ium-4-yl)prop-2-enylidene]benzo[e][1,3]benzothiazole;4-methylbenzenesulfonate (PubChem CID 162340128) has the molecular formula C35H34N2O3S2 and a molecular weight of 594.80 g/mol. Its IUPAC name is 1-ethyl-2-[3-(1-propan-2-ylquinolin-1-ium-4-yl)prop-2-enylidene]benzo[e][1,3]benzothiazole;4-methylbenzenesulfonate.
| Compound Name | 1-ethyl-2-[3-(1-propan-2-ylquinolin-1-ium-4-yl)prop-2-enylidene]benzo[e][1,3]benzothiazole;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162340128 |
| Molecular Formula | C35H34N2O3S2 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 1-ethyl-2-[3-(1-propan-2-ylquinolin-1-ium-4-yl)prop-2-enylidene]benzo[e][1,3]benzothiazole;4-methylbenzenesulfonate |
| SMILES | CCN1C(=CC=Cc2cc[n+](C(C)C)c3ccccc23)Sc2ccc3ccccc3c21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C28H27N2S.C7H8O3S/c1-4-29-27(31-26-17-16-21-10-5-6-13-24(21)28(26)29)15-9-11-22-18-19-30(20(2)3)25-14-8-7-12-23(22)25;1-6-2-4-7(5-3-6)11(8,9)10/h5-20H,4H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | WSGYBAXFGCNPAK-UHFFFAOYSA-M |
| XLogP | 8.25 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|