C23H23IN2S — CID 170853992
1-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)-N-(4-methylphenyl)propan-2-imine;hydroiodide (PubChem CID 170853992) has the molecular formula C23H23IN2S and a molecular weight of 486.42 g/mol. Its IUPAC name is 1-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)-N-(4-methylphenyl)propan-2-imine;hydroiodide.
| Compound Name | 1-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)-N-(4-methylphenyl)propan-2-imine;hydroiodide |
|---|---|
| PubChem CID | 170853992 |
| Molecular Formula | C23H23IN2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 1-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)-N-(4-methylphenyl)propan-2-imine;hydroiodide |
| SMILES | CCN1C(=C/C(C)=N/c2ccc(C)cc2)Sc2ccc3ccccc3c21.I |
| InChI | InChI=1S/C23H22N2S.HI/c1-4-25-22(15-17(3)24-19-12-9-16(2)10-13-19)26-21-14-11-18-7-5-6-8-20(18)23(21)25;/h5-15H,4H2,1-3H3;1H/b22-15?,24-17+; |
| InChIKey | XSYJASTXUKJIIC-FGNUVVNKSA-N |
| XLogP | 7.33 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|