C21H17NO4S — CID 91744290
3-acetyl-6-[(Z)-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]pyran-2,4-dione (PubChem CID 91744290) has the molecular formula C21H17NO4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 3-acetyl-6-[(Z)-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]pyran-2,4-dione.
| Compound Name | 3-acetyl-6-[(Z)-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]pyran-2,4-dione |
|---|---|
| PubChem CID | 91744290 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-acetyl-6-[(Z)-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]pyran-2,4-dione |
| SMILES | CCN1/C(=C/C2=CC(=O)C(C(C)=O)C(=O)O2)Sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C21H17NO4S/c1-3-22-18(11-14-10-16(24)19(12(2)23)21(25)26-14)27-17-9-8-13-6-4-5-7-15(13)20(17)22/h4-11,19H,3H2,1-2H3/b18-11- |
| InChIKey | OEDSROXQZCJJFE-WQRHYEAKSA-N |
| XLogP | 3.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_B(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|