C27H26ClNO3S3 — CID 91512483
[5-chloro-2-[(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]-1-benzothiophen-3-yl]methanesulfonic acid;ethene (PubChem CID 91512483) has the molecular formula C27H26ClNO3S3 and a molecular weight of 544.16 g/mol. Its IUPAC name is [5-chloro-2-[(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]-1-benzothiophen-3-yl]methanesulfonic acid;ethene.
| Compound Name | [5-chloro-2-[(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]-1-benzothiophen-3-yl]methanesulfonic acid;ethene |
|---|---|
| PubChem CID | 91512483 |
| Molecular Formula | C27H26ClNO3S3 |
| Molecular Weight | 544.16 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | [5-chloro-2-[(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]-1-benzothiophen-3-yl]methanesulfonic acid;ethene |
| SMILES | C=C.C=C.CCN1C(=Cc2sc3ccc(Cl)cc3c2CS(=O)(=O)O)Sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C23H18ClNO3S3.2C2H4/c1-2-25-22(30-20-9-7-14-5-3-4-6-16(14)23(20)25)12-21-18(13-31(26,27)28)17-11-15(24)8-10-19(17)29-21;2*1-2/h3-12H,2,13H2,1H3,(H,26,27,28);2*1-2H2 |
| InChIKey | PNCFFOQWSYKAQY-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.16 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|