C34H35N2O4S3+ — CID 91334356
ethene;[2-[2-[[1-(2-hydroxyethyl)benzo[e][1,3]benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]methanesulfonic acid (PubChem CID 91334356) has the molecular formula C34H35N2O4S3+ and a molecular weight of 631.87 g/mol. Its IUPAC name is ethene;[2-[2-[[1-(2-hydroxyethyl)benzo[e][1,3]benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]methanesulfonic acid.
| Compound Name | ethene;[2-[2-[[1-(2-hydroxyethyl)benzo[e][1,3]benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 91334356 |
| Molecular Formula | C34H35N2O4S3+ |
| Molecular Weight | 631.87 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | ethene;[2-[2-[[1-(2-hydroxyethyl)benzo[e][1,3]benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]methanesulfonic acid |
| SMILES | C=C.C=C.CCC(=Cc1sc2ccc3ccccc3c2[n+]1CS(=O)(=O)O)C=C1Sc2ccc3ccccc3c2N1CCO |
| InChI | InChI=1S/C30H26N2O4S3.2C2H4/c1-2-20(17-27-31(15-16-33)29-23-9-5-3-7-21(23)11-13-25(29)37-27)18-28-32(19-39(34,35)36)30-24-10-6-4-8-22(24)12-14-26(30)38-28;2*1-2/h3-14,17-18,33H,2,15-16,19H2,1H3;2*1-2H2/p+1 |
| InChIKey | HWDBYJPGWWHDPX-UHFFFAOYSA-O |
| XLogP | 8.18 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.87 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|