C31H30N2O6S5 — CID 25251073
3-[2-[(E)-2-[(E)-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-2-ylidene]methyl]but-1-enyl]thieno[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 25251073) has the molecular formula C31H30N2O6S5 and a molecular weight of 686.92 g/mol. Its IUPAC name is 3-[2-[(E)-2-[(E)-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-2-ylidene]methyl]but-1-enyl]thieno[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E)-2-[(E)-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-2-ylidene]methyl]but-1-enyl]thieno[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 25251073 |
| Molecular Formula | C31H30N2O6S5 |
| Molecular Weight | 686.92 g/mol |
| Exact Mass | 686.07 |
| IUPAC Name | 3-[2-[(E)-2-[(E)-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-2-ylidene]methyl]but-1-enyl]thieno[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCC(=C\c1sc2ccc3sccc3c2[n+]1CCCS(=O)(=O)[O-])/C=C1/Sc2ccc3ccccc3c2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C31H30N2O6S5/c1-2-21(20-29-33(15-6-18-44(37,38)39)31-24-13-16-40-25(24)11-12-27(31)42-29)19-28-32(14-5-17-43(34,35)36)30-23-8-4-3-7-22(23)9-10-26(30)41-28/h3-4,7-13,16,19-20H,2,5-6,14-15,17-18H2,1H3,(H-,34,35,36,37,38,39) |
| InChIKey | XTSZACALKVLABM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.92 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|