C21H31N2O3S2+ — CID 161007583
3-(2-methylidenebenzo[e][1,3]benzothiazol-1-yl)propane-1-sulfonic acid;triethylazanium (PubChem CID 161007583) has the molecular formula C21H31N2O3S2+ and a molecular weight of 423.62 g/mol. Its IUPAC name is 3-(2-methylidenebenzo[e][1,3]benzothiazol-1-yl)propane-1-sulfonic acid;triethylazanium.
| Compound Name | 3-(2-methylidenebenzo[e][1,3]benzothiazol-1-yl)propane-1-sulfonic acid;triethylazanium |
|---|---|
| PubChem CID | 161007583 |
| Molecular Formula | C21H31N2O3S2+ |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-(2-methylidenebenzo[e][1,3]benzothiazol-1-yl)propane-1-sulfonic acid;triethylazanium |
| SMILES | C=C1Sc2ccc3ccccc3c2N1CCCS(=O)(=O)O.CC[NH+](CC)CC |
| InChI | InChI=1S/C15H15NO3S2.C6H15N/c1-11-16(9-4-10-21(17,18)19)15-13-6-3-2-5-12(13)7-8-14(15)20-11;1-4-7(5-2)6-3/h2-3,5-8H,1,4,9-10H2,(H,17,18,19);4-6H2,1-3H3/p+1 |
| InChIKey | TWSAHWXMNZGCJL-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|