C11H12ClNO3S2 — CID 59938970
3-(6-chloro-2-methylidene-1,3-benzothiazol-3-yl)propane-1-sulfonic acid (PubChem CID 59938970) has the molecular formula C11H12ClNO3S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 3-(6-chloro-2-methylidene-1,3-benzothiazol-3-yl)propane-1-sulfonic acid.
| Compound Name | 3-(6-chloro-2-methylidene-1,3-benzothiazol-3-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59938970 |
| Molecular Formula | C11H12ClNO3S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 3-(6-chloro-2-methylidene-1,3-benzothiazol-3-yl)propane-1-sulfonic acid |
| SMILES | C=C1Sc2cc(Cl)ccc2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C11H12ClNO3S2/c1-8-13(5-2-6-18(14,15)16)10-4-3-9(12)7-11(10)17-8/h3-4,7H,1-2,5-6H2,(H,14,15,16) |
| InChIKey | VYPBMJDCCNLBIO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|