C11H15ClN2O4S2 — CID 174420216
3-[5-chloro-2-[(hydroxyamino)methyl]-2H-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 174420216) has the molecular formula C11H15ClN2O4S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 3-[5-chloro-2-[(hydroxyamino)methyl]-2H-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-chloro-2-[(hydroxyamino)methyl]-2H-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174420216 |
| Molecular Formula | C11H15ClN2O4S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 3-[5-chloro-2-[(hydroxyamino)methyl]-2H-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCN1c2cc(Cl)ccc2SC1CNO |
| InChI | InChI=1S/C11H15ClN2O4S2/c12-8-2-3-10-9(6-8)14(11(19-10)7-13-15)4-1-5-20(16,17)18/h2-3,6,11,13,15H,1,4-5,7H2,(H,16,17,18) |
| InChIKey | XIMWVLJFENVEFB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|