C16H20ClNO3S2 — CID 54391716
3-[5-chloro-2-(2-ethylbuta-1,3-dienyl)-2H-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 54391716) has the molecular formula C16H20ClNO3S2 and a molecular weight of 373.93 g/mol. Its IUPAC name is 3-[5-chloro-2-(2-ethylbuta-1,3-dienyl)-2H-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-chloro-2-(2-ethylbuta-1,3-dienyl)-2H-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54391716 |
| Molecular Formula | C16H20ClNO3S2 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 3-[5-chloro-2-(2-ethylbuta-1,3-dienyl)-2H-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | C=CC(=CC1Sc2ccc(Cl)cc2N1CCCS(=O)(=O)O)CC |
| InChI | InChI=1S/C16H20ClNO3S2/c1-3-12(4-2)10-16-18(8-5-9-23(19,20)21)14-11-13(17)6-7-15(14)22-16/h3,6-7,10-11,16H,1,4-5,8-9H2,2H3,(H,19,20,21) |
| InChIKey | VHCABDQXUKYQFS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|