C21H19Cl2FN2O6S4 — CID 177425177
3-[5-chloro-2-[(Z)-[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]-fluoromethyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 177425177) has the molecular formula C21H19Cl2FN2O6S4 and a molecular weight of 613.56 g/mol. Its IUPAC name is 3-[5-chloro-2-[(Z)-[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]-fluoromethyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[5-chloro-2-[(Z)-[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]-fluoromethyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 177425177 |
| Molecular Formula | C21H19Cl2FN2O6S4 |
| Molecular Weight | 613.56 g/mol |
| Exact Mass | 611.95 |
| IUPAC Name | 3-[5-chloro-2-[(Z)-[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]-fluoromethyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[n+]1c(/C(F)=C2/Sc3ccc(Cl)cc3N2CCCS(=O)(=O)O)sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H19Cl2FN2O6S4/c22-13-3-5-17-15(11-13)25(7-1-9-35(27,28)29)20(33-17)19(24)21-26(8-2-10-36(30,31)32)16-12-14(23)4-6-18(16)34-21/h3-6,11-12H,1-2,7-10H2,(H-,27,28,29,30,31,32) |
| InChIKey | GKMPYVBRCFHJHP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|