C15H14ClNO3S2 — CID 54547856
3-(1-chlorophenothiazin-10-yl)propane-1-sulfonic acid (PubChem CID 54547856) has the molecular formula C15H14ClNO3S2 and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-(1-chlorophenothiazin-10-yl)propane-1-sulfonic acid.
| Compound Name | 3-(1-chlorophenothiazin-10-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54547856 |
| Molecular Formula | C15H14ClNO3S2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 3-(1-chlorophenothiazin-10-yl)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCN1c2ccccc2Sc2cccc(Cl)c21 |
| InChI | InChI=1S/C15H14ClNO3S2/c16-11-5-3-8-14-15(11)17(9-4-10-22(18,19)20)12-6-1-2-7-13(12)21-14/h1-3,5-8H,4,9-10H2,(H,18,19,20) |
| InChIKey | ZHUUKIJXPJLRMN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|