C19H16N2O4S4 — CID 3336304
3-[2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 3336304) has the molecular formula C19H16N2O4S4 and a molecular weight of 464.62 g/mol. Its IUPAC name is 3-[2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 3336304 |
| Molecular Formula | C19H16N2O4S4 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | 3-[2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | O=C1C(=C2Sc3ccccc3N2CCCS(=O)(=O)O)SC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C19H16N2O4S4/c22-17-16(28-19(26)21(17)13-7-2-1-3-8-13)18-20(11-6-12-29(23,24)25)14-9-4-5-10-15(14)27-18/h1-5,7-10H,6,11-12H2,(H,23,24,25) |
| InChIKey | UIJPWAAHRCPQHN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|