C16H16N2O3S3 — CID 11079439
5-[(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid (PubChem CID 11079439) has the molecular formula C16H16N2O3S3 and a molecular weight of 380.52 g/mol. Its IUPAC name is 5-[(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid.
| Compound Name | 5-[(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 11079439 |
| Molecular Formula | C16H16N2O3S3 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 5-[(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
| SMILES | CN1/C(=C2\SC(=S)N(CCCCC(=O)O)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C16H16N2O3S3/c1-17-10-6-2-3-7-11(10)23-15(17)13-14(21)18(16(22)24-13)9-5-4-8-12(19)20/h2-3,6-7H,4-5,8-9H2,1H3,(H,19,20)/b15-13+ |
| InChIKey | SIKXDWCZYYCUEK-FYWRMAATSA-N |
| XLogP | 3.51 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|