C17H18N2O2S4 — CID 91738691
S-[3-[(2E)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propyl] ethanethioate (PubChem CID 91738691) has the molecular formula C17H18N2O2S4 and a molecular weight of 410.61 g/mol. Its IUPAC name is S-[3-[(2E)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propyl] ethanethioate.
| Compound Name | S-[3-[(2E)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propyl] ethanethioate |
|---|---|
| PubChem CID | 91738691 |
| Molecular Formula | C17H18N2O2S4 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | S-[3-[(2E)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]propyl] ethanethioate |
| SMILES | CCN1C(=O)/C(=C2\Sc3ccccc3N2CCCSC(C)=O)SC1=S |
| InChI | InChI=1S/C17H18N2O2S4/c1-3-18-15(21)14(25-17(18)22)16-19(9-6-10-23-11(2)20)12-7-4-5-8-13(12)24-16/h4-5,7-8H,3,6,9-10H2,1-2H3/b16-14+ |
| InChIKey | LHIUVCZOZJGHOQ-JQIJEIRASA-N |
| XLogP | 4.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|