C26H17Cl6N5O3S3 — CID 59986156
2-[(2E)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]ethyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate (PubChem CID 59986156) has the molecular formula C26H17Cl6N5O3S3 and a molecular weight of 756.37 g/mol. Its IUPAC name is 2-[(2E)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]ethyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate.
| Compound Name | 2-[(2E)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]ethyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
|---|---|
| PubChem CID | 59986156 |
| Molecular Formula | C26H17Cl6N5O3S3 |
| Molecular Weight | 756.37 g/mol |
| Exact Mass | 752.86 |
| IUPAC Name | 2-[(2E)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1,3-benzothiazol-3-yl]ethyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
| SMILES | CCN1C(=O)/C(=C2\Sc3ccccc3N2CCOC(=O)c2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc2)SC1=S |
| InChI | InChI=1S/C26H17Cl6N5O3S3/c1-2-36-19(38)17(43-24(36)41)20-37(15-5-3-4-6-16(15)42-20)11-12-40-21(39)14-9-7-13(8-10-14)18-33-22(25(27,28)29)35-23(34-18)26(30,31)32/h3-10H,2,11-12H2,1H3/b20-17+ |
| InChIKey | YBWHWENNVXPNRE-LVZFUZTISA-N |
| XLogP | 8.01 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.37 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|