C14H11F3N2O3S4 — CID 3134991
(5Z)-3-ethyl-5-[3-methyl-5-(trifluoromethylsulfonyl)-1,3-benzothiazol-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3134991) has the molecular formula C14H11F3N2O3S4 and a molecular weight of 440.52 g/mol. Its IUPAC name is (5Z)-3-ethyl-5-[3-methyl-5-(trifluoromethylsulfonyl)-1,3-benzothiazol-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-ethyl-5-[3-methyl-5-(trifluoromethylsulfonyl)-1,3-benzothiazol-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3134991 |
| Molecular Formula | C14H11F3N2O3S4 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | (5Z)-3-ethyl-5-[3-methyl-5-(trifluoromethylsulfonyl)-1,3-benzothiazol-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2/Sc3ccc(S(=O)(=O)C(F)(F)F)cc3N2C)SC1=S |
| InChI | InChI=1S/C14H11F3N2O3S4/c1-3-19-11(20)10(25-13(19)23)12-18(2)8-6-7(4-5-9(8)24-12)26(21,22)14(15,16)17/h4-6H,3H2,1-2H3/b12-10- |
| InChIKey | LBKOKQPFABHBRZ-BENRWUELSA-N |
| XLogP | 3.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|