C15H16N2OS4 — CID 23600128
(5E)-3-ethyl-5-[3-ethyl-5-(sulfanylmethyl)-1,3-benzothiazol-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 23600128) has the molecular formula C15H16N2OS4 and a molecular weight of 368.57 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[3-ethyl-5-(sulfanylmethyl)-1,3-benzothiazol-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-[3-ethyl-5-(sulfanylmethyl)-1,3-benzothiazol-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23600128 |
| Molecular Formula | C15H16N2OS4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | (5E)-3-ethyl-5-[3-ethyl-5-(sulfanylmethyl)-1,3-benzothiazol-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2\Sc3ccc(CS)cc3N2CC)SC1=S |
| InChI | InChI=1S/C15H16N2OS4/c1-3-16-10-7-9(8-19)5-6-11(10)21-14(16)12-13(18)17(4-2)15(20)22-12/h5-7,19H,3-4,8H2,1-2H3/b14-12+ |
| InChIKey | TWERJSZNRHTCCQ-WYMLVPIESA-N |
| XLogP | 4.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|