C27H19Cl6N5O4S3 — CID 59986147
(5E)-3-[2-[3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-oxopropoxy]ethoxy]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 59986147) has the molecular formula C27H19Cl6N5O4S3 and a molecular weight of 786.40 g/mol. Its IUPAC name is (5E)-3-[2-[3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-oxopropoxy]ethoxy]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[2-[3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-oxopropoxy]ethoxy]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 59986147 |
| Molecular Formula | C27H19Cl6N5O4S3 |
| Molecular Weight | 786.40 g/mol |
| Exact Mass | 782.87 |
| IUPAC Name | (5E)-3-[2-[3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-oxopropoxy]ethoxy]-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1/C(=C2\SC(=S)N(OCCOCCC(=O)c3ccc(-c4nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n4)cc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C27H19Cl6N5O4S3/c1-37-16-4-2-3-5-18(16)44-22(37)19-21(40)38(25(43)45-19)42-13-12-41-11-10-17(39)14-6-8-15(9-7-14)20-34-23(26(28,29)30)36-24(35-20)27(31,32)33/h2-9H,10-13H2,1H3/b22-19+ |
| InChIKey | UCGNGUMYCWFPSA-ZBJSNUHESA-N |
| XLogP | 7.98 |
| TPSA | 97.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.40 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|