C19H23NO3S2 — CID 54183187
3-(4-butylphenothiazin-10-yl)propane-1-sulfonic acid (PubChem CID 54183187) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-(4-butylphenothiazin-10-yl)propane-1-sulfonic acid.
| Compound Name | 3-(4-butylphenothiazin-10-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54183187 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-(4-butylphenothiazin-10-yl)propane-1-sulfonic acid |
| SMILES | CCCCc1cccc2c1Sc1ccccc1N2CCCS(=O)(=O)O |
| InChI | InChI=1S/C19H23NO3S2/c1-2-3-8-15-9-6-11-17-19(15)24-18-12-5-4-10-16(18)20(17)13-7-14-25(21,22)23/h4-6,9-12H,2-3,7-8,13-14H2,1H3,(H,21,22,23) |
| InChIKey | PDHOKLPOKAJFRT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|