C17H19NO3S2 — CID 139603670
3-(4,6-dimethylphenothiazin-10-yl)propane-1-sulfonic acid (PubChem CID 139603670) has the molecular formula C17H19NO3S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 3-(4,6-dimethylphenothiazin-10-yl)propane-1-sulfonic acid.
| Compound Name | 3-(4,6-dimethylphenothiazin-10-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139603670 |
| Molecular Formula | C17H19NO3S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 3-(4,6-dimethylphenothiazin-10-yl)propane-1-sulfonic acid |
| SMILES | Cc1cccc2c1Sc1c(C)cccc1N2CCCS(=O)(=O)O |
| InChI | InChI=1S/C17H19NO3S2/c1-12-6-3-8-14-16(12)22-17-13(2)7-4-9-15(17)18(14)10-5-11-23(19,20)21/h3-4,6-9H,5,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | SGGMPAVIELDJNT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|