C28H41NO3S2 — CID 172538291
4-(4,6-dihexylphenothiazin-10-yl)butane-2-sulfonic acid (PubChem CID 172538291) has the molecular formula C28H41NO3S2 and a molecular weight of 503.77 g/mol. Its IUPAC name is 4-(4,6-dihexylphenothiazin-10-yl)butane-2-sulfonic acid.
| Compound Name | 4-(4,6-dihexylphenothiazin-10-yl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 172538291 |
| Molecular Formula | C28H41NO3S2 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 4-(4,6-dihexylphenothiazin-10-yl)butane-2-sulfonic acid |
| SMILES | CCCCCCc1cccc2c1Sc1c(CCCCCC)cccc1N2CCC(C)S(=O)(=O)O |
| InChI | InChI=1S/C28H41NO3S2/c1-4-6-8-10-14-23-16-12-18-25-27(23)33-28-24(15-11-9-7-5-2)17-13-19-26(28)29(25)21-20-22(3)34(30,31)32/h12-13,16-19,22H,4-11,14-15,20-21H2,1-3H3,(H,30,31,32) |
| InChIKey | VJGOONAHSAXHKW-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|