C28H40NNaO3S2 — CID 172538243
sodium 4-(1,9-dihexylphenothiazin-10-yl)butane-2-sulfonate (PubChem CID 172538243) has the molecular formula C28H40NNaO3S2 and a molecular weight of 525.76 g/mol. Its IUPAC name is sodium 4-(1,9-dihexylphenothiazin-10-yl)butane-2-sulfonate.
| Compound Name | sodium 4-(1,9-dihexylphenothiazin-10-yl)butane-2-sulfonate |
|---|---|
| PubChem CID | 172538243 |
| Molecular Formula | C28H40NNaO3S2 |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | sodium 4-(1,9-dihexylphenothiazin-10-yl)butane-2-sulfonate |
| SMILES | CCCCCCc1cccc2c1N(CCC(C)S(=O)(=O)[O-])c1c(CCCCCC)cccc1S2.[Na+] |
| InChI | InChI=1S/C28H41NO3S2.Na/c1-4-6-8-10-14-23-16-12-18-25-27(23)29(21-20-22(3)34(30,31)32)28-24(15-11-9-7-5-2)17-13-19-26(28)33-25;/h12-13,16-19,22H,4-11,14-15,20-21H2,1-3H3,(H,30,31,32);/q;+1/p-1 |
| InChIKey | KBRGHIBCJZNOTR-UHFFFAOYSA-M |
| XLogP | 4.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|