C18H20NNaO3S2 — CID 57336662
sodium 6-phenothiazin-10-ylhexane-1-sulfonate (PubChem CID 57336662) has the molecular formula C18H20NNaO3S2 and a molecular weight of 385.49 g/mol. Its IUPAC name is sodium 6-phenothiazin-10-ylhexane-1-sulfonate.
| Compound Name | sodium 6-phenothiazin-10-ylhexane-1-sulfonate |
|---|---|
| PubChem CID | 57336662 |
| Molecular Formula | C18H20NNaO3S2 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | sodium 6-phenothiazin-10-ylhexane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCCCN1c2ccccc2Sc2ccccc21.[Na+] |
| InChI | InChI=1S/C18H21NO3S2.Na/c20-24(21,22)14-8-2-1-7-13-19-15-9-3-5-11-17(15)23-18-12-6-4-10-16(18)19;/h3-6,9-12H,1-2,7-8,13-14H2,(H,20,21,22);/q;+1/p-1 |
| InChIKey | CEEHJPNKBMDQNR-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|