C18H14Cl2N2O5S4 — CID 20744028
3-[(2Z)-2-[[3-(carboxymethyl)-5-chlorothieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-6-chloro-1,3-benzothiazol-3-yl]propane-1-sulfonate (PubChem CID 20744028) has the molecular formula C18H14Cl2N2O5S4 and a molecular weight of 537.49 g/mol. Its IUPAC name is 3-[(2Z)-2-[[3-(carboxymethyl)-5-chlorothieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-6-chloro-1,3-benzothiazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[(2Z)-2-[[3-(carboxymethyl)-5-chlorothieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-6-chloro-1,3-benzothiazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20744028 |
| Molecular Formula | C18H14Cl2N2O5S4 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 535.92 |
| IUPAC Name | 3-[(2Z)-2-[[3-(carboxymethyl)-5-chlorothieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-6-chloro-1,3-benzothiazol-3-yl]propane-1-sulfonate |
| SMILES | O=C(O)C[n+]1c(/C=C2\Sc3cc(Cl)ccc3N2CCCS(=O)(=O)[O-])sc2cc(Cl)sc21 |
| InChI | InChI=1S/C18H14Cl2N2O5S4/c19-10-2-3-11-12(6-10)28-15(21(11)4-1-5-31(25,26)27)8-16-22(9-17(23)24)18-13(29-16)7-14(20)30-18/h2-3,6-8H,1,4-5,9H2,(H-,23,24,25,26,27) |
| InChIKey | PXTGPPUBLHUXFS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|