C38H41N2O6S4+ — CID 102068555
3-[2-[2-ethyl-3-methyl-5-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]hepta-2,4-dienylidene]benzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid (PubChem CID 102068555) has the molecular formula C38H41N2O6S4+ and a molecular weight of 750.02 g/mol. Its IUPAC name is 3-[2-[2-ethyl-3-methyl-5-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]hepta-2,4-dienylidene]benzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-ethyl-3-methyl-5-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]hepta-2,4-dienylidene]benzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 102068555 |
| Molecular Formula | C38H41N2O6S4+ |
| Molecular Weight | 750.02 g/mol |
| Exact Mass | 749.18 |
| IUPAC Name | 3-[2-[2-ethyl-3-methyl-5-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]hepta-2,4-dienylidene]benzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(=CC(C)=C(C=C1Sc2ccc3ccccc3c2N1CCCS(=O)(=O)O)CC)c1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O |
| InChI | InChI=1S/C38H40N2O6S4/c1-4-27(25-35-39(20-10-22-49(41,42)43)36-31-14-8-6-12-29(31)16-18-33(36)47-35)26(3)24-28(5-2)38-40(21-11-23-50(44,45)46)37-32-15-9-7-13-30(32)17-19-34(37)48-38/h6-9,12-19,24-25H,4-5,10-11,20-23H2,1-3H3,(H-,41,42,43,44,45,46)/p+1 |
| InChIKey | IKRYVCAQXALGCL-UHFFFAOYSA-O |
| XLogP | 9.02 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.02 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|