C33H35N2O6S4+ — CID 59104893
3-[2-[2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butyl]-2H-benzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid (PubChem CID 59104893) has the molecular formula C33H35N2O6S4+ and a molecular weight of 683.92 g/mol. Its IUPAC name is 3-[2-[2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butyl]-2H-benzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butyl]-2H-benzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59104893 |
| Molecular Formula | C33H35N2O6S4+ |
| Molecular Weight | 683.92 g/mol |
| Exact Mass | 683.14 |
| IUPAC Name | 3-[2-[2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butyl]-2H-benzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(=Cc1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O)CC1Sc2ccc3ccccc3c2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C33H34N2O6S4/c1-2-23(21-30-34(17-7-19-44(36,37)38)32-26-11-5-3-9-24(26)13-15-28(32)42-30)22-31-35(18-8-20-45(39,40)41)33-27-12-6-4-10-25(27)14-16-29(33)43-31/h3-6,9-16,21,31H,2,7-8,17-20,22H2,1H3,(H-,36,37,38,39,40,41)/p+1 |
| InChIKey | HVASOKUOCFGQHV-UHFFFAOYSA-O |
| XLogP | 7.17 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.92 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|