C37H35N2O7S3+ — CID 59062129
3-[(2Z)-2-[(2E)-2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]naphtho[2,3-e][1,3]benzoxazol-1-yl]propane-1-sulfonic acid (PubChem CID 59062129) has the molecular formula C37H35N2O7S3+ and a molecular weight of 715.90 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2E)-2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]naphtho[2,3-e][1,3]benzoxazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-2-[(2E)-2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]naphtho[2,3-e][1,3]benzoxazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59062129 |
| Molecular Formula | C37H35N2O7S3+ |
| Molecular Weight | 715.90 g/mol |
| Exact Mass | 715.16 |
| IUPAC Name | 3-[(2Z)-2-[(2E)-2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]naphtho[2,3-e][1,3]benzoxazol-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(/C=C1\Oc2ccc3cc4ccccc4cc3c2N1CCCS(=O)(=O)O)=C\c1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O |
| InChI | InChI=1S/C37H34N2O7S3/c1-2-25(22-35-39(18-8-20-49(43,44)45)37-30-12-6-5-9-26(30)14-16-33(37)47-35)21-34-38(17-7-19-48(40,41)42)36-31-24-28-11-4-3-10-27(28)23-29(31)13-15-32(36)46-34/h3-6,9-16,21-24H,2,7-8,17-20H2,1H3,(H-,40,41,42,43,44,45)/p+1 |
| InChIKey | WUXXDSILYRINFU-UHFFFAOYSA-O |
| XLogP | 7.74 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.90 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|