C28H31N2O8S3+ — CID 20600389
3-[2-[(E)-2-[(Z)-[5,6-dimethyl-3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]furo[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 20600389) has the molecular formula C28H31N2O8S3+ and a molecular weight of 619.76 g/mol. Its IUPAC name is 3-[2-[(E)-2-[(Z)-[5,6-dimethyl-3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]furo[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E)-2-[(Z)-[5,6-dimethyl-3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]furo[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20600389 |
| Molecular Formula | C28H31N2O8S3+ |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | 3-[2-[(E)-2-[(Z)-[5,6-dimethyl-3-(2-sulfoethyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]furo[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(/C=C1\Oc2cc(C)c(C)cc2N1CCS(=O)(=O)O)=C\c1sc2ccc3occc3c2[n+]1CCCS(=O)(=O)O |
| InChI | InChI=1S/C28H30N2O8S3/c1-4-20(16-26-29(10-13-41(34,35)36)22-14-18(2)19(3)15-24(22)38-26)17-27-30(9-5-12-40(31,32)33)28-21-8-11-37-23(21)6-7-25(28)39-27/h6-8,11,14-17H,4-5,9-10,12-13H2,1-3H3,(H-,31,32,33,34,35,36)/p+1 |
| InChIKey | GFZLGHUVXHRJOT-UHFFFAOYSA-O |
| XLogP | 5.25 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|