C22H18FN2O6S3+ — CID 20600330
2-[(2Z)-5-fluoro-2-[[1-(3-sulfopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]acetic acid (PubChem CID 20600330) has the molecular formula C22H18FN2O6S3+ and a molecular weight of 521.59 g/mol. Its IUPAC name is 2-[(2Z)-5-fluoro-2-[[1-(3-sulfopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[(2Z)-5-fluoro-2-[[1-(3-sulfopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 20600330 |
| Molecular Formula | C22H18FN2O6S3+ |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 2-[(2Z)-5-fluoro-2-[[1-(3-sulfopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]acetic acid |
| SMILES | O=C(O)CN1/C(=C/c2sc3ccc4occc4c3[n+]2CCCS(=O)(=O)O)Sc2ccc(F)cc21 |
| InChI | InChI=1S/C22H17FN2O6S3/c23-13-2-4-17-15(10-13)25(12-21(26)27)20(32-17)11-19-24(7-1-9-34(28,29)30)22-14-6-8-31-16(14)3-5-18(22)33-19/h2-6,8,10-11H,1,7,9,12H2,(H-,26,27,28,29,30)/p+1 |
| InChIKey | ZHOIHINLSHEVJN-UHFFFAOYSA-O |
| XLogP | 4.35 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|