C35H36ClN4O4S3+ — CID 54175548
3-[2-[[5-chloro-3-[[[2-(4-methyl-N-propan-2-ylanilino)acetyl]amino]methyl]-1,3-benzothiazol-2-ylidene]methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 54175548) has the molecular formula C35H36ClN4O4S3+ and a molecular weight of 708.35 g/mol. Its IUPAC name is 3-[2-[[5-chloro-3-[[[2-(4-methyl-N-propan-2-ylanilino)acetyl]amino]methyl]-1,3-benzothiazol-2-ylidene]methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[[5-chloro-3-[[[2-(4-methyl-N-propan-2-ylanilino)acetyl]amino]methyl]-1,3-benzothiazol-2-ylidene]methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54175548 |
| Molecular Formula | C35H36ClN4O4S3+ |
| Molecular Weight | 708.35 g/mol |
| Exact Mass | 707.16 |
| IUPAC Name | 3-[2-[[5-chloro-3-[[[2-(4-methyl-N-propan-2-ylanilino)acetyl]amino]methyl]-1,3-benzothiazol-2-ylidene]methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | Cc1ccc(N(CC(=O)NCN2C(=Cc3sc4ccc5ccccc5c4[n+]3CCCS(=O)(=O)O)Sc3ccc(Cl)cc32)C(C)C)cc1 |
| InChI | InChI=1S/C35H35ClN4O4S3/c1-23(2)39(27-13-9-24(3)10-14-27)21-32(41)37-22-40-29-19-26(36)12-16-30(29)45-34(40)20-33-38(17-6-18-47(42,43)44)35-28-8-5-4-7-25(28)11-15-31(35)46-33/h4-5,7-16,19-20,23H,6,17-18,21-22H2,1-3H3,(H-,37,41,42,43,44)/p+1 |
| InChIKey | YQJWHPNOJQQCEC-UHFFFAOYSA-O |
| XLogP | 7.48 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.35 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|